For research use only. Not for therapeutic Use.
Carbendazim-d4 is a deuterated form of carbendazim, a fungicide commonly used to control fungal diseases in crops. In this version, four hydrogen atoms are replaced with deuterium, making it useful for research purposes. The deuterium labeling allows for precise tracking and analysis of the compound in environmental and toxicological studies, particularly using mass spectrometry. This enables researchers to study the metabolism, degradation, and environmental fate of carbendazim, providing insights into its behavior in ecosystems and its potential impact on human health.
| CAS Number | 291765-95-2 |
| Synonyms | N-1H-(Benzimidazol-d4)-2-yl-carbamic Acid Methyl Ester; 2-(Benzimidazole-d4)carbamic Acid Methyl Ester; Carbendazole-d4; BMC-d4; MBC-d4; BCM-d4; BAS-3460-d4; BAS-67054-d4; CTR-6669; |
| Molecular Formula | C9H9N3O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl N-(4,5,6,7-tetradeuterio-1H-benzimidazol-2-yl)carbamate |
| InChI | InChI=1S/C9H9N3O2/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8/h2-5H,1H3,(H2,10,11,12,13)/i2D,3D,4D,5D |
| InChIKey | TWFZGCMQGLPBSX-QFFDRWTDSA-N |
| SMILES | COC(=O)NC1=NC2=CC=CC=C2N1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |