For research use only. Not for therapeutic Use.
Carazolol（Cat No.:I011427）is a non-selective beta-adrenergic antagonist used primarily in the treatment of hypertension and certain heart conditions. By blocking beta receptors in the heart, it reduces heart rate, cardiac output, and blood pressure. Additionally, it has some alpha-blocking properties, which further contribute to its blood pressure-lowering effects. Carazolol is also utilized in managing arrhythmias and preventing angina. Common side effects may include fatigue, dizziness, and bradycardia. It should be used cautiously in individuals with respiratory conditions like asthma, due to its non-selective beta-blocking action.
| CAS Number | 57775-29-8 |
| Synonyms | 1-(9H-carbazol-4-yloxy)-3-(propan-2-ylamino)propan-2-ol |
| Molecular Formula | C18H22N2O2 |
| Purity | ≥95% |
| IUPAC Name | 1-(9H-carbazol-4-yloxy)-3-(propan-2-ylamino)propan-2-ol |
| InChI | InChI=1S/C18H22N2O2/c1-12(2)19-10-13(21)11-22-17-9-5-8-16-18(17)14-6-3-4-7-15(14)20-16/h3-9,12-13,19-21H,10-11H2,1-2H3 |
| InChIKey | BQXQGZPYHWWCEB-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=CC2=C1C3=CC=CC=C3N2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
