For research use only. Not for therapeutic Use.
Captan(Cat No.:R049499)is a broad-spectrum fungicide widely used in agriculture to protect fruits, vegetables, and ornamental plants from various fungal diseases, including blights, molds, and rots. It works by disrupting fungal cellular processes, effectively inhibiting spore germination and growth. Applied as a foliar spray or seed treatment, Captan provides preventive control, reducing crop losses and improving yields. Its effectiveness and low toxicity to humans make it popular in integrated pest management. Captan’s fungicidal properties make it essential for sustainable agriculture, safeguarding crops against pathogenic fungi while supporting high-quality production.
| CAS Number | 133-06-2 |
| Synonyms | 3a,4,7,7a-Tetrahydro-2-[(trichloromethyl)thio]-1H-isoindole-1,3(2H)-dione; N-[(Trichloromethyl)thio]tetrahydrophthalimide; N-[(Trichloromethyl)thio]-4-c?yclohexene-1,2-dicarboximide; N-Trichloromethylthio-3a,4,7,7a-tetrahydrophthalimide; Trimegol; Ug |
| Molecular Formula | C9H8Cl3NO2S |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | 2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| InChI | InChI=1S/C9H8Cl3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-2,5-6H,3-4H2 |
| InChIKey | LDVVMCZRFWMZSG-UHFFFAOYSA-N |
| SMILES | C1C=CCC2C1C(=O)N(C2=O)SC(Cl)(Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |