For research use only. Not for therapeutic Use.
Capravirine, also known as AG-1549; AG 549; S-1153, is a non-nucleoside reverse transcriptase inhibitor potentially for the treatment of HIV infection.
| CAS Number | 178979-85-6 |
| Molecular Formula | C20H20Cl2N4O2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methyl carbamate |
| InChI | InChI=1S/C20H20Cl2N4O2S/c1-12(2)18-19(29-16-8-14(21)7-15(22)9-16)26(10-13-3-5-24-6-4-13)17(25-18)11-28-20(23)27/h3-9,12H,10-11H2,1-2H3,(H2,23,27) |
| InChIKey | YQXCVAGCMNFUMQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N(C(=N1)COC(=O)N)CC2=CC=NC=C2)SC3=CC(=CC(=C3)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |