For research use only. Not for therapeutic Use.
Cambendazole(Cat No.:R020109)is a benzimidazole-class anthelmintic compound known for its ability to inhibit microtubule polymerization by binding to β-tubulin, thereby disrupting cell division and nutrient absorption in parasitic worms. It has shown efficacy against a range of gastrointestinal helminths in veterinary and laboratory settings. Cambendazole’s mechanism of action involves impairing the structural integrity of parasite cytoskeletal components, leading to immobilization and death. It is used in parasitology research to study antiparasitic mechanisms and evaluate benzimidazole resistance. Cambendazole also serves as a scaffold for developing novel microtubule-targeting agents.
| CAS Number | 26097-80-3 |
| Synonyms | propan-2-yl N-[2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-yl]carbamate |
| Molecular Formula | C14H14N4O2S |
| Purity | ≥95% |
| IUPAC Name | propan-2-yl N-[2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-yl]carbamate |
| InChI | InChI=1S/C14H14N4O2S/c1-8(2)20-14(19)16-9-3-4-10-11(5-9)18-13(17-10)12-6-21-7-15-12/h3-8H,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | QZWHWHNCPFEXLL-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)NC1=CC2=C(C=C1)N=C(N2)C3=CSC=N3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |