For research use only. Not for therapeutic Use.
(+)-Butin（Cat No.:I044929）is a naturally occurring flavonoid belonging to the flavanone subclass, found in various plants such as Dalbergia odorifera and other legumes. It exhibits a range of pharmacological activities, including antioxidant, anti-inflammatory, and anticancer effects. The (+) stereoisomer is known for its free radical scavenging capacity, contributing to cellular protection against oxidative stress. (+)-Butin also influences key signaling pathways involved in inflammation and apoptosis, making it a promising candidate for therapeutic research. Its presence in traditional medicinal plants underscores its relevance in natural product-based drug discovery and functional health applications.
| CAS Number | 74628-42-5 |
| Synonyms | (2R)-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrochromen-4-one |
| Molecular Formula | C15H12O5 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C15H12O5/c16-9-2-3-10-12(18)7-14(20-15(10)6-9)8-1-4-11(17)13(19)5-8/h1-6,14,16-17,19H,7H2/t14-/m1/s1 |
| InChIKey | MJBPUQUGJNAPAZ-CQSZACIVSA-N |
| SMILES | C1[C@@H](OC2=C(C1=O)C=CC(=C2)O)C3=CC(=C(C=C3)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
