For research use only. Not for therapeutic Use.
Butetamate(Cat No.:M062566) is a chemical compound that falls under the category of esters. Specifically, it is recognized for its medical use as a sedative and antispasmodic agent. In medical settings, Bustamante is utilized to help relax muscles and reduce spasms, providing relief in various conditions that involve involuntary muscle contractions. Its sedative properties also make it effective in calming anxiety and inducing sleep under certain circumstances. Butetamate’s application in healthcare highlights its importance in managing symptoms related to muscle spasms and stress-related disorders, contributing to patient comfort and recovery.
| CAS Number | 14007-64-8 |
| Molecular Formula | C16H25NO2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-(diethylamino)ethyl 2-phenylbutanoate |
| InChI | InChI=1S/C16H25NO2/c1-4-15(14-10-8-7-9-11-14)16(18)19-13-12-17(5-2)6-3/h7-11,15H,4-6,12-13H2,1-3H3 |
| InChIKey | CKWHSYRZDLWQFV-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=CC=C1)C(=O)OCCN(CC)CC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |