For research use only. Not for therapeutic Use.
Bunamidine hydrochloride（Cat No.:M071157）is an anthelmintic compound primarily used in veterinary medicine to treat parasitic infections, particularly tapeworm infestations in dogs. It acts by disrupting parasite energy metabolism, impairing their ability to maintain vital functions, leading to immobilization and death. Bunamidine hydrochloride is administered orally and exhibits high efficacy against a range of cestodes, with minimal toxicity when used at therapeutic doses. As a research tool, it aids in studying parasite physiology and drug mechanisms. Its targeted action makes it valuable for controlling parasitic diseases in animal health management.
| CAS Number | 1055-55-6 |
| Synonyms | N,N-dibutyl-4-hexoxynaphthalene-1-carboximidamide;hydrochloride |
| Molecular Formula | C25H39ClN2O |
| Purity | ≥95% |
| IUPAC Name | N,N-dibutyl-4-hexoxynaphthalene-1-carboximidamide;hydrochloride |
| InChI | InChI=1S/C25H38N2O.ClH/c1-4-7-10-13-20-28-24-17-16-23(21-14-11-12-15-22(21)24)25(26)27(18-8-5-2)19-9-6-3;/h11-12,14-17,26H,4-10,13,18-20H2,1-3H3;1H |
| InChIKey | PBYJDHRFPFHVKZ-UHFFFAOYSA-N |
| SMILES | CCCCCCOC1=CC=C(C2=CC=CC=C21)C(=N)N(CCCC)CCCC.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
