For research use only. Not for therapeutic Use.
Tetrapotassium; 2-[2-[2-[3-(1,3-Benzothiazol-2-yl)-7-[bis(carboxylatomethyl)amino]-2-oxochromen-6-yl]oxyethoxy]-N-(carboxylatomethyl)-4-methylanilino]acetate(CAT: R066649) is a complex chemical compound that acts as a fluorescent dye, often used in various biological and chemical research applications. This compound is part of the class of chelating agents, designed to bind metal ions, and is utilized in techniques such as fluorescence microscopy, flow cytometry, and bioimaging. Its structure includes a benzothiazole ring and a chromenone group, contributing to its ability to fluoresce under specific conditions. The tetrapotassium salt form enhances the compound’s solubility and stability in aqueous solutions, making it ideal for use in biological assays where precise detection and visualization of specific cellular components are required.
| CAS Number | 216453-54-2 |
| Synonyms | N-[3-(2-benzothiazolyl)-6-[2-[2-[bis(carboxymethyl)amino]-5-methylphenoxy]ethoxy]-2-oxo-2H-1-benzopyran-7-yl]-N-(carboxymethyl)-glycine, tetrapotassium salt |
| Molecular Formula | C33H29K4N3O12S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[2-[2-[3-(1,3-benzothiazol-2-yl)-7-[bis(carboxymethyl)amino]-2-oxochromen-6-yl]oxyethoxy]-N-(carboxymethyl)-4-methylanilino]acetic acid;potassium |
| InChI | InChI=1S/C33H29N3O12S.4K/c1-18-6-7-22(35(14-28(37)38)15-29(39)40)25(10-18)46-8-9-47-26-12-19-11-20(32-34-21-4-2-3-5-27(21)49-32)33(45)48-24(19)13-23(26)36(16-30(41)42)17-31(43)44;;;;/h2-7,10-13H,8-9,14-17H2,1H3,(H,37,38)(H,39,40)(H,41,42)(H,43,44);;;; |
| InChIKey | GJGJUFNSARDRFE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N(CC(=O)O)CC(=O)O)OCCOC2=C(C=C3C(=C2)C=C(C(=O)O3)C4=NC5=CC=CC=C5S4)N(CC(=O)O)CC(=O)O.[K].[K].[K].[K] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |