For research use only. Not for therapeutic Use.
Bruceine B（Cat No.:R066454）is a bioactive quassinoid compound isolated from Brucea javanica, a plant traditionally used in Chinese medicine. It is known for its potent anticancer, anti-inflammatory, and antimalarial properties. Bruceine B exerts cytotoxic effects against various cancer cell lines by inducing apoptosis, cell cycle arrest, and suppressing metastasis through pathways such as PI3K/Akt and STAT3. Additionally, it has demonstrated the ability to inhibit inflammation by reducing pro-inflammatory cytokines. Its complex tetracyclic structure contributes to its high biological activity, making it a promising lead compound in oncology and inflammation-related drug research.
| CAS Number | 25514-29-8 |
| Synonyms | methyl (1R,2S,3R,6R,8R,13S,14R,15R,16S,17S)-3-acetyloxy-10,15,16-trihydroxy-9,13-dimethyl-4,11-dioxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-ene-17-carboxylate |
| Molecular Formula | C23H28O11 |
| Purity | ≥95% |
| IUPAC Name | methyl (1R,2S,3R,6R,8R,13S,14R,15R,16S,17S)-3-acetyloxy-10,15,16-trihydroxy-9,13-dimethyl-4,11-dioxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-ene-17-carboxylate |
| InChI | InChI=1S/C23H28O11/c1-8-10-5-12-22-7-32-23(20(30)31-4,17(22)15(19(29)34-12)33-9(2)24)18(28)14(27)16(22)21(10,3)6-11(25)13(8)26/h10,12,14-18,26-28H,5-7H2,1-4H3/t10-,12+,14+,15+,16+,17+,18-,21-,22+,23-/m0/s1 |
| InChIKey | YDWODLQEUPYKGJ-LZFWDZGBSA-N |
| SMILES | CC1=C(C(=O)C[C@]2([C@H]1C[C@@H]3[C@]45[C@@H]2[C@H]([C@@H]([C@]([C@@H]4[C@H](C(=O)O3)OC(=O)C)(OC5)C(=O)OC)O)O)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
