For research use only. Not for therapeutic Use.
Broussoflavonol F（Cat No.:I044800）is a flavonoid compound isolated from Broussonetia papyrifera, a plant used in traditional Asian medicine. It belongs to the flavonol subclass and exhibits notable bioactivities, including anticancer, anti-inflammatory, and antioxidant effects. Broussoflavonol F has been studied for its ability to inhibit cancer cell proliferation, induce apoptosis, and suppress inflammatory pathways such as NF-κB and MAPK signaling. Its antioxidant properties help protect cells from oxidative stress. Due to its multifaceted pharmacological potential, Broussoflavonol F is considered a promising lead compound in natural product-based drug discovery and development.
| CAS Number | 162558-94-3 |
| Synonyms | 3,5,7-trihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-8-(3-methylbut-2-enyl)chromen-4-one |
| Molecular Formula | C25H26O6 |
| Purity | ≥95% |
| IUPAC Name | 3,5,7-trihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-8-(3-methylbut-2-enyl)chromen-4-one |
| InChI | InChI=1S/C25H26O6/c1-13(2)5-7-15-11-16(8-10-18(15)26)24-23(30)22(29)21-20(28)12-19(27)17(25(21)31-24)9-6-14(3)4/h5-6,8,10-12,26-28,30H,7,9H2,1-4H3 |
| InChIKey | KNMMNUQOUANAJS-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C(=C3O2)CC=C(C)C)O)O)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
