For research use only. Not for therapeutic Use.
Bromo-PEG6-bromide(CAT: I016884) is a homobifunctional polyethylene glycol (PEG) linker terminated with bromide groups at both ends of a six-unit PEG spacer. The reactive bromo groups undergo nucleophilic substitution with thiols, amines, or other nucleophiles, enabling efficient covalent coupling in organic and aqueous systems. The PEG6 chain provides hydrophilicity, flexibility, and reduced steric hindrance, supporting stable conjugation while improving solubility. This reagent is particularly useful for crosslinking, surface modification, polymer functionalization, and bioconjugation applications, allowing controlled spacing between molecules. With its balanced reactivity and solubility profile, Bromo-PEG6-bromide is a versatile tool for chemical biology, materials science, and drug delivery research.
| CAS Number | 72713-23-6 |
| Synonyms | 1,2-bis[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethane |
| Molecular Formula | C14H28Br2O6 |
| Purity | ≥95% |
| IUPAC Name | 1,2-bis[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethane |
| InChI | InChI=1S/C14H28Br2O6/c15-1-3-17-5-7-19-9-11-21-13-14-22-12-10-20-8-6-18-4-2-16/h1-14H2 |
| InChIKey | ODSLOCVIDIOUPB-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCBr)OCCOCCOCCBr |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
