For research use only. Not for therapeutic Use.
Bromo-PEG5-azide（Cat No.:I015792）is a heterobifunctional polyethylene glycol linker designed for efficient and versatile conjugation. It features a terminal bromide group, which readily undergoes nucleophilic substitution with thiols, amines, or other nucleophiles, and an azide group that participates in copper-catalyzed or strain-promoted click chemistry with alkynes. The PEG5 spacer enhances hydrophilicity, flexibility, and solubility while reducing steric hindrance, ensuring efficient reactivity in aqueous and organic media. This reagent is widely applied in chemical biology, proteomics, biomaterials, and drug discovery, supporting modular assembly and multifunctional molecular engineering strategies.
| CAS Number | 1402411-90-8 |
| Synonyms | 1-azido-2-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethane |
| Molecular Formula | C12H24BrN3O5 |
| Purity | ≥95% |
| IUPAC Name | 1-azido-2-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethane |
| InChI | InChI=1S/C12H24BrN3O5/c13-1-3-17-5-7-19-9-11-21-12-10-20-8-6-18-4-2-15-16-14/h1-12H2 |
| InChIKey | KTOVCBYDDDWFOX-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCBr)N=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
