Brimonidine Tartrate(Cat No.:A000158)is an alpha-2 adrenergic receptor agonist used primarily to treat open-angle glaucoma and ocular hypertension. By decreasing aqueous humor production and increasing uveoscleral outflow, it effectively lowers intraocular pressure. Additionally, Brimonidine Tartrate is used in topical formulations to reduce facial redness in conditions like rosacea. Its dual action and targeted mechanism make it a valuable medication in ophthalmology and dermatology. The drug’s efficacy and safety profile ensure its continued use in managing chronic eye conditions and certain dermatological issues.
Catalog Number | A000158 |
CAS Number | 70359-46-5 |
Synonyms | BRIMONIDINE TARTRATE; 70359-46-5; Brimonidine tartarate; Brominide tartrate; Alphagan; Brimonidine D-tartrate |
Molecular Formula | C15H16BrN5O6 |
Purity | 95% |
Target | Adrenergic Receptor Agonist |
Storage | -20°C |
Overview of Clinical Research | Originator: Pfizer<br /> |
IUPAC Name | 5-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine;(2R,3R)-2,3-dihydroxybutanedioic acid |
InChI | InChI=1S/C11H10BrN5.C4H6O6/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8;5-1(3(7)8)2(6)4(9)10/h1-4H,5-6H2,(H2,15,16,17);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
InChIKey | QZHBYNSSDLTCRG-LREBCSMRSA-N |
SMILES | C1CN=C(N1)NC2=C(C3=NC=CN=C3C=C2)Br.C(C(C(=O)O)O)(C(=O)O)O |