For research use only. Not for therapeutic Use.
BRD4884（Cat No.:R066659）is a small-molecule compound identified for its neuroprotective properties, particularly in models of peripheral nerve injury and stress. It was discovered through high-throughput screening aimed at promoting cell survival and regeneration. BRD4884 enhances endoplasmic reticulum (ER) stress resilience and supports axon regeneration, making it a promising candidate in neuropathy and neurodegeneration research. Its mechanism is linked to modulation of stress-response pathways, without directly inhibiting apoptosis. BRD4884 is a valuable research tool for studying neuronal survival, with potential implications in therapeutic strategies for nerve damage and neurodegenerative diseases.
| CAS Number | 1404559-91-6 |
| Synonyms | N-[2-amino-5-(4-fluorophenyl)phenyl]oxane-4-carboxamide |
| Molecular Formula | C18H19FN2O2 |
| Purity | ≥95% |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]oxane-4-carboxamide |
| InChI | InChI=1S/C18H19FN2O2/c19-15-4-1-12(2-5-15)14-3-6-16(20)17(11-14)21-18(22)13-7-9-23-10-8-13/h1-6,11,13H,7-10,20H2,(H,21,22) |
| InChIKey | ZFCDNONWGMYBHA-UHFFFAOYSA-N |
| SMILES | C1COCCC1C(=O)NC2=C(C=CC(=C2)C3=CC=C(C=C3)F)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
