For research use only. Not for therapeutic Use.
BRD3731（Cat No.:I044369）is a small-molecule inhibitor identified through high-throughput screening for its selective activity against isocitrate dehydrogenase 1 (IDH1) mutations, particularly the cancer-associated R132H mutant. By targeting mutant IDH1, BRD3731 blocks the production of the oncometabolite 2-hydroxyglutarate (2-HG), which disrupts epigenetic regulation and cellular differentiation. This inhibition restores normal cell function and reduces tumorigenic potential in IDH1-mutant cancers such as glioma and acute myeloid leukemia (AML). BRD3731 is valuable for studying IDH1-related metabolic dysregulation and represents a promising lead compound for targeted cancer therapy development.
| CAS Number | 2056262-07-6 |
| Synonyms | (4S)-3-(2,2-dimethylpropyl)-4,7,7-trimethyl-4-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| Molecular Formula | C24H31N3O |
| Purity | ≥95% |
| IUPAC Name | (4S)-3-(2,2-dimethylpropyl)-4,7,7-trimethyl-4-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| InChI | InChI=1S/C24H31N3O/c1-22(2,3)12-17-20-21(27-26-17)25-16-13-23(4,5)14-18(28)19(16)24(20,6)15-10-8-7-9-11-15/h7-11H,12-14H2,1-6H3,(H2,25,26,27)/t24-/m1/s1 |
| InChIKey | YZRXTIGAQRIAEX-XMMPIXPASA-N |
| SMILES | C[C@]1(C2=C(CC(CC2=O)(C)C)NC3=NNC(=C31)CC(C)(C)C)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
