For research use only. Not for therapeutic Use.
BrBzGCp2（Cat No.:I014547）is a synthetic cyclopentadienyl-based compound featuring a bromobenzyl (BrBz) substituent and two Cp (cyclopentadienyl) ligands. It is commonly utilized in organometallic chemistry and materials science, particularly in the development of metallocene catalysts and transition metal complexes. The bromobenzyl group allows for further functionalization or coupling reactions, expanding its versatility in chemical synthesis. BrBzGCp2 serves as a building block in the creation of novel coordination compounds, polymers, and advanced materials. Its structural attributes contribute to fine-tuning electronic properties and reactivity profiles in catalysis and molecular engineering applications.
| CAS Number | 166038-00-2 |
| Synonyms | cyclopentyl (2S)-2-amino-5-[[(2R)-3-[(4-bromophenyl)methylsulfanyl]-1-[(2-cyclopentyloxy-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate |
| Molecular Formula | C27H38BrN3O6S |
| Purity | ≥95% |
| IUPAC Name | cyclopentyl (2S)-2-amino-5-[[(2R)-3-[(4-bromophenyl)methylsulfanyl]-1-[(2-cyclopentyloxy-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate |
| InChI | InChI=1S/C27H38BrN3O6S/c28-19-11-9-18(10-12-19)16-38-17-23(26(34)30-15-25(33)36-20-5-1-2-6-20)31-24(32)14-13-22(29)27(35)37-21-7-3-4-8-21/h9-12,20-23H,1-8,13-17,29H2,(H,30,34)(H,31,32)/t22-,23-/m0/s1 |
| InChIKey | QIFSPGPRHFNZNN-GOTSBHOMSA-N |
| SMILES | C1CCC(C1)OC(=O)CNC(=O)[C@H](CSCC2=CC=C(C=C2)Br)NC(=O)CC[C@@H](C(=O)OC3CCCC3)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
