For research use only. Not for therapeutic Use.
Brassinazole（Cat No.:I045877）is a triazole-type synthetic compound and the first identified specific inhibitor of brassinosteroid biosynthesis in plants. By blocking the cytochrome P450 enzyme DWARF4 (DWF4), it suppresses brassinosteroid production, leading to dwarfism, reduced cell elongation, and altered photomorphogenesis. Brassinazole has become an essential chemical tool in plant biology research, allowing scientists to study brassinosteroid-regulated processes such as growth, development, and stress responses. Its application has advanced understanding of plant hormone signaling networks and provided insights into how brassinosteroid pathways integrate with other phytohormonal and environmental regulatory systems.
| CAS Number | 280129-83-1 |
| Synonyms | (2S,3R)-4-(4-chlorophenyl)-2-phenyl-3-(1,2,4-triazol-1-yl)butan-2-ol |
| Molecular Formula | C18H18ClN3O |
| Purity | ≥95% |
| IUPAC Name | (2S,3R)-4-(4-chlorophenyl)-2-phenyl-3-(1,2,4-triazol-1-yl)butan-2-ol |
| InChI | InChI=1S/C18H18ClN3O/c1-18(23,15-5-3-2-4-6-15)17(22-13-20-12-21-22)11-14-7-9-16(19)10-8-14/h2-10,12-13,17,23H,11H2,1H3/t17-,18+/m1/s1 |
| InChIKey | YULDTPKHZNKFEY-MSOLQXFVSA-N |
| SMILES | C[C@](C1=CC=CC=C1)([C@@H](CC2=CC=C(C=C2)Cl)N3C=NC=N3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
