For research use only. Not for therapeutic Use.
Bradanicline (Cat No.:I045059) is a selective partial agonist of the α7 nicotinic acetylcholine receptor (α7 nAChR), a receptor involved in cognitive function, neuroplasticity, and inflammatory regulation. It has been investigated for its potential to enhance memory, attention, and sensory gating, particularly in conditions such as schizophrenia, Alzheimer’s disease, and attention-deficit disorders. By modulating cholinergic signaling, Bradanicline may improve cognitive deficits without the side effects associated with non-selective cholinergic agents. It is a valuable compound in neuropsychiatric and cognitive research.
| CAS Number | 639489-84-2 |
| Synonyms | N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]-1-benzofuran-2-carboxamide |
| Molecular Formula | C22H23N3O2 |
| Purity | ≥95% |
| IUPAC Name | N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]-1-benzofuran-2-carboxamide |
| InChI | InChI=1S/C22H23N3O2/c26-22(20-13-17-5-1-2-6-19(17)27-20)24-21-16-7-10-25(11-8-16)18(21)12-15-4-3-9-23-14-15/h1-6,9,13-14,16,18,21H,7-8,10-12H2,(H,24,26)/t18-,21+/m0/s1 |
| InChIKey | OXKRFEWMSWPKKV-GHTZIAJQSA-N |
| SMILES | C1CN2CCC1[C@H]([C@@H]2CC3=CN=CC=C3)NC(=O)C4=CC5=CC=CC=C5O4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
