BQU57 (CAT: I002131) is a compound that exhibits selective inhibition of Ral, a small GTPase protein involved in cell signaling pathways. BQU57 specifically targets Ral without significant inhibition of Ras or Rho, two other related GTPases. By selectively inhibiting Ral, BQU57 disrupts Ral-mediated signaling cascades, which are involved in various cellular processes such as cell growth, survival, and migration. Studies have shown that BQU57’s inhibition of Ral can result in the inhibition of xenograft tumor growth, similar to the effects observed with depletion of Ral using siRNA (small interfering RNA).
Catalog Number | I002131 |
CAS Number | 1637739-82-2 |
Synonyms | 6-amino-1,3-dimethyl-4-(4-(trifluoromethyl)phenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
Molecular Formula | C16H13F3N4O |
Purity | 95% |
Target | Ras-like GTPases |
Solubility | DMSO: ≥ 36 mg/mL |
Storage | Store at -20°C |
IC50 | 2.0 μM (H2122 cell), 1.3 μM (H358 cell) |
IUPAC Name | 6-amino-1,3-dimethyl-4-[4-(trifluoromethyl)phenyl]-4H-pyrano[2,3-c]pyrazole-5-carbonitrile |
InChI | InChI=1S/C16H13F3N4O/c1-8-12-13(9-3-5-10(6-4-9)16(17,18)19)11(7-20)14(21)24-15(12)23(2)22-8/h3-6,13H,21H2,1-2H3 |
InChIKey | IJCMHHSFXFMZAI-UHFFFAOYSA-N |
SMILES | CC1=NN(C2=C1C(C(=C(O2)N)C#N)C3=CC=C(C=C3)C(F)(F)F)C |
Reference | <p style=/line-height:25px/> |