For research use only. Not for therapeutic Use.
BPR1J-097(Cat No.:I001246)is a selective and potent inhibitor of the protein kinase TBK1 (TANK-binding kinase 1), which plays a crucial role in regulating immune responses and inflammation. By targeting TBK1, BPR1J-097 has potential therapeutic applications in inflammatory diseases and certain types of cancer, where TBK1 is involved in the activation of immune cells and the production of pro-inflammatory cytokines. It has been studied for its effects in conditions like autoimmune diseases, neuroinflammation, and tumors. Ongoing research is focused on evaluating its safety, efficacy, and potential for treating diseases driven by excessive inflammation.
CAS Number | 1327167-19-0 |
Molecular Formula | C27H28N6O3S |
Purity | ≥95% |
Target | FLT3 |
Solubility | DMSO:32mg/mL |
Storage | Store at +4C |
IC50 | 11±7 nM(Flt3);3 nM (FLT-3 D835Y) |
IUPAC Name | N-[5-[3-(benzenesulfonamido)phenyl]-1H-pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide |
InChI | InChI=1S/C27H28N6O3S/c1-32-14-16-33(17-15-32)23-12-10-20(11-13-23)27(34)28-26-19-25(29-30-26)21-6-5-7-22(18-21)31-37(35,36)24-8-3-2-4-9-24/h2-13,18-19,31H,14-17H2,1H3,(H2,28,29,30,34) |
InChIKey | RRKKHABFIOHAOI-UHFFFAOYSA-N |
SMILES | CN1CCN(CC1)C2=CC=C(C=C2)C(=O)NC3=NNC(=C3)C4=CC(=CC=C4)NS(=O)(=O)C5=CC=CC=C5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |