For research use only. Not for therapeutic Use.
bPiDI (Cat No.: I040175) is a compound used in biochemical and pharmacological research, often in studies focused on protein interactions and molecular signaling pathways. It acts as a selective inhibitor of specific enzymes or receptors, playing a role in modulating cellular processes such as growth, differentiation, and survival. bPiDI is primarily studied for its potential therapeutic applications in diseases where dysregulated signaling is involved, such as cancer, autoimmune disorders, or neurodegenerative diseases. Its mechanism of action and clinical benefits are subjects of ongoing research.
| CAS Number | 525596-64-9 |
| Synonyms | 3-methyl-1-[10-(3-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;diiodide |
| Molecular Formula | C22H34I2N2 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H34N2.2HI/c1-21-13-11-17-23(19-21)15-9-7-5-3-4-6-8-10-16-24-18-12-14-22(2)20-24;;/h11-14,17-20H,3-10,15-16H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | GMIGEVLABVAPDI-UHFFFAOYSA-L |
| SMILES | CC1=C[N+](=CC=C1)CCCCCCCCCC[N+]2=CC=CC(=C2)C.[I-].[I-] |
| Reference | [1]. Thomas E Wooters, et al. bPiDI: a novel selective α6β2* nicotinic receptor antagonist and preclinical candidate treatment for nicotine abuse. Br J Pharmacol. 2011, 163,2. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |