For research use only. Not for therapeutic Use.
BPD-B-1,4-diene(CAT: I004794) is a photosensitizer compound used in photodynamic therapy (PDT) research. It belongs to the bacteriochlorin class of compounds, which exhibit strong absorption in the near-infrared region, allowing for deeper tissue penetration during light activation. Upon activation by light, BPD-B-1,4-diene generates reactive oxygen species (ROS) that induce cellular damage and apoptosis, making it particularly useful in cancer therapy and antimicrobial applications. Its high phototoxicity and selectivity for targeted tissues make it a valuable tool for advancing photomedicine and exploring novel therapeutic strategies in oncology and beyond.
| CAS Number | 94238-43-4 |
| Synonyms | BPD-B-1,4-diene, Benzoporphyrin Ring B 1,4-diene.;23H,25H-Benzo[b]porphine-9,13-dipropanoic acid, 19-ethenyl-3,22a-dihydro-1,2-bis(methoxycarbonyl)-8,14,18, 22a-tetramethyl-, dimethyl ester |
| Molecular Formula | C42H44N4O8 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term or -20 °C for long term |
| SMILES | O=C(CCC1=C(C)C2=N/C1=CC3=C(CCC(OC)=O)C(C)=C(N3)/C=C4N=C(C(C54C)=CCC(C(OC)=O)=C5C(OC)=O)/C=C(C(C=C)=C/6C)NC6=C/2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |