For research use only. Not for therapeutic Use.
Bourgeonal (Cat No.: R002885) is an aromatic aldehyde known for its strong floral, lily-of-the-valley scent. It is widely used in the fragrance industry for perfumes, soaps, and personal care products. Beyond its olfactory appeal, bourgeonal is of scientific interest for its ability to activate olfactory receptors, including those found in human sperm cells, suggesting a potential role in chemotaxis. Its molecular structure includes an aromatic ring with an aldehyde and a tert-butyl group, making it both volatile and highly fragrant.
| CAS Number | 18127-01-0 |
| Synonyms | 4-tert-Butylbenzenepropionaldehyde; 4-(1,1-Dimethylethyl)benzenepropanal; 3-(4-tert-Butylphenyl)propanal; |
| Molecular Formula | C13H18O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(4-tert-butylphenyl)propanal |
| InChI | InChI=1S/C13H18O/c1-13(2,3)12-8-6-11(7-9-12)5-4-10-14/h6-10H,4-5H2,1-3H3 |
| InChIKey | FZJUFJKVIYFBSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CCC=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
