Boric Acid(Cat No.:R022643)is a high-purity inorganic compound widely used in various industries due to its antiseptic, insecticidal, and preservative properties. In healthcare, it serves as an antimicrobial agent in eye washes and antiseptic solutions. It is also utilized in agriculture as a micronutrient for plants, enhancing growth and development. In industrial applications, boric acid is a crucial component in the production of glass, ceramics, and fiberglass, improving durability and heat resistance. Its versatile applications and efficacy make it essential for advancements in healthcare, agriculture, and materials science.
Catalog Number | R022643 |
CAS Number | 10043-35-3 |
Synonyms | Basilit B; Boracic Acid; Boric Acid; Boric Acid (B(OH)3); Borofax; Boron Trihydroxide; Bushwhacker; CB BORiD; Dia Flea-Mate; Dr.’s 1 Flea Terminator DF; Dr.’s 1 Flea Terminator DFPBO; Dr.’s 1 Flea Terminator DT; Dr.’s 1 Flea Terminator DTPBO; Entimad |
Molecular Formula | H3BO3 |
Purity | 0% |
Target | Reagents |
Solubility | Soluble to 600 mM in sterile water |
Storage | Store at RT |
IUPAC Name | boric acid |
InChI | InChI=1S/BH3O3/c2-1(3)4/h2-4H |
InChIKey | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
SMILES | B(O)(O)O |