For research use only. Not for therapeutic Use.
Bomedemstat hydrochloride（Cat No.:I042852）is an investigational small molecule inhibitor of the lysine-specific demethylase 1 (LSD1), an enzyme involved in regulating gene expression and cellular differentiation. By inhibiting LSD1, Bomedemstat hydrochloride aims to modify the epigenetic landscape of cancer cells, potentially reversing abnormal gene silencing and improving the immune response against tumors. It is being studied primarily for its potential in treating hematologic malignancies, such as leukemia and myeloproliferative disorders. Ongoing clinical trials are evaluating its safety, efficacy, and potential as a novel therapy in combination with other cancer treatments.
| Synonyms | N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]-4-(triazol-1-yl)benzamide;hydrochloride |
| Molecular Formula | C28H35ClFN7O2 |
| Purity | ≥95% |
| IUPAC Name | N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]-4-(triazol-1-yl)benzamide;hydrochloride |
| InChI | InChI=1S/C28H34FN7O2.ClH/c1-34-15-17-35(18-16-34)28(38)25(3-2-12-30-26-19-24(26)20-4-8-22(29)9-5-20)32-27(37)21-6-10-23(11-7-21)36-14-13-31-33-36;/h4-11,13-14,24-26,30H,2-3,12,15-19H2,1H3,(H,32,37);1H/t24-,25-,26+;/m0./s1 |
| InChIKey | SVTQVUBVQOSRKS-KGLRHMGQSA-N |
| SMILES | CN1CCN(CC1)C(=O)[C@H](CCCN[C@@H]2C[C@H]2C3=CC=C(C=C3)F)NC(=O)C4=CC=C(C=C4)N5C=CN=N5.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
