For research use only. Not for therapeutic Use.
Boeravinone B（Cat No.:M132465）is a rotenoid-type flavonoid isolated from Boerhavia diffusa, a plant widely used in traditional Ayurvedic medicine. It exhibits a broad spectrum of pharmacological properties, including anticancer, anti-inflammatory, antioxidant, and hepatoprotective effects. Boeravinone B has been shown to inhibit P-glycoprotein, making it a potential agent in overcoming multidrug resistance in cancer therapy. It also modulates inflammatory responses by suppressing NF-κB activation and reducing pro-inflammatory cytokines. With its distinctive polyphenolic structure, Boeravinone B holds promise as a lead compound for developing treatments targeting cancer, liver disorders, and inflammation-driven diseases.
| CAS Number | 114567-34-9 |
| Synonyms | 6,9,11-trihydroxy-10-methyl-6H-chromeno[3,4-b]chromen-12-one |
| Molecular Formula | C17H12O6 |
| Purity | ≥95% |
| IUPAC Name | 6,9,11-trihydroxy-10-methyl-6H-chromeno[3,4-b]chromen-12-one |
| InChI | InChI=1S/C17H12O6/c1-7-9(18)6-11-13(14(7)19)15(20)12-8-4-2-3-5-10(8)23-17(21)16(12)22-11/h2-6,17-19,21H,1H3 |
| InChIKey | YVVDYYFGAWQOGB-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1O)OC3=C(C2=O)C4=CC=CC=C4OC3O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
