For research use only. Not for therapeutic Use.
Bocidelpar（Cat No.:I045301）is an investigational selective peroxisome proliferator-activated receptor delta (PPARδ) agonist being developed for the treatment of primary biliary cholangitis (PBC) and other metabolic or inflammatory disorders. By activating PPARδ, bocidelpar modulates gene expression involved in lipid metabolism, inflammation control, and mitochondrial function, potentially improving liver health and reducing disease progression. Preclinical and early clinical studies suggest it can lower cholestatic markers, enhance bile acid regulation, and improve patient-reported symptoms. Its selectivity aims to maximize therapeutic benefit while minimizing off-target effects, making it a promising candidate for precision liver disease therapy.
| CAS Number | 2095128-20-2 |
| Synonyms | (3R)-3-methyl-6-[2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid |
| Molecular Formula | C25H27F3N2O3 |
| Purity | ≥95% |
| IUPAC Name | (3R)-3-methyl-6-[2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenoxy]hexanoic acid |
| InChI | InChI=1S/C25H27F3N2O3/c1-17(14-23(31)32)6-5-13-33-22-8-4-3-7-20(22)16-30-18(2)15-29-24(30)19-9-11-21(12-10-19)25(26,27)28/h3-4,7-12,15,17H,5-6,13-14,16H2,1-2H3,(H,31,32)/t17-/m1/s1 |
| InChIKey | FMOPHFSPINWSOV-QGZVFWFLSA-N |
| SMILES | CC1=CN=C(N1CC2=CC=CC=C2OCCC[C@@H](C)CC(=O)O)C3=CC=C(C=C3)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
