For research use only. Not for therapeutic Use.
Boc-L-Valine (Cat No.: R042581) is a protected form of the essential amino acid L-valine, where the amino group is blocked with a tert-butoxycarbonyl (Boc) group. This protection prevents unwanted side reactions during peptide synthesis, making it a crucial reagent in solid-phase and solution-phase peptide assembly. The Boc group is easily removed under acidic conditions, allowing for sequential chain elongation. Boc-L-Valine is widely used in pharmaceutical research, peptide-based drug development, and biochemical studies. It is intended strictly for laboratory and research use.
| CAS Number | 13734-41-3 |
| Synonyms | N-[(1,1-dimethylethoxy)carbonyl]-L-valine;?(2S)-2-(tert-Butoxycarbonylamino)-3-methylbutanoic Acid; (2S)-2-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-methylbutanoic Acid; (S)-2-(tert-Butoxycarbonylamino)-3-methylbutanoic Acid; (S)-N-tert-Butoxycarbonylv |
| Molecular Formula | C10H19NO4 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChI | InChI=1S/C10H19NO4/c1-6(2)7(8(12)13)11-9(14)15-10(3,4)5/h6-7H,1-5H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
| InChIKey | SZXBQTSZISFIAO-ZETCQYMHSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)OC(C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |