For research use only. Not for therapeutic Use.
BMVC2 (CAT: I016837) is a bisubstituted carbazole derivative of BMVC and functions as a selective G-quadruplex (G4) stabilizer. It enhances G4 structural stability, as demonstrated in assays with the human telomeric sequence d[AG₃(T₂AG₃)₃] (HT22), where BMVC2 prolongs unfolding times (τ₁ ≈ 133.7 s, 29%; τ₂ ≈ 2816 s, 71%), closely resembling the stabilization profile of BMVC. By reinforcing G-quadruplex DNA, BMVC2 is a valuable chemical probe for studying telomere biology, genomic stability, and G4-targeted therapeutic strategies. It offers potential in cancer research and drug discovery aimed at modulating telomeric and oncogenic G4 structures.
| CAS Number | 850559-51-2 |
| Synonyms | 3,6-bis[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-9H-carbazole;diiodide |
| Molecular Formula | C28H25I2N3 |
| Purity | ≥95% |
| IUPAC Name | 3,6-bis[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-9H-carbazole;diiodide |
| InChI | InChI=1S/C28H24N3.2HI/c1-30-17-5-3-7-23(30)13-9-21-11-15-27-25(19-21)26-20-22(12-16-28(26)29-27)10-14-24-8-4-6-18-31(24)2;;/h3-20H,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | KSHYRGPLGVYWRF-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=CC=C1C=CC2=CC3=C(C=C2)NC4=C3C=C(C=C4)C=CC5=CC=CC=[N+]5C.[I-].[I-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
