For research use only. Not for therapeutic Use.
BMVC(CAT: I016838) is a potent G-quadruplex (G4) stabilizer and selective telomerase inhibitor with an IC₅₀ of ~0.2 μM. It increases the melting temperature of telomeric G4 structures, accelerates telomere shortening, and inhibits Taq DNA polymerase (IC₅₀ ~2.5 μM). In cancer cells (e.g., H1299), BMVC (0.5 μM, long-term) induces apoptosis and senescence, characterized by β-galactosidase activity, DNA damage foci, and telomere uncapping. BMVC also suppresses migration, colony formation, and anchorage-independent growth. In vivo, BMVC (1 mg/kg, i.p., every 3 days) delays tumorigenic potential in mouse xenograft models, highlighting its value as a telomeric G4-targeting anticancer probe.
| CAS Number | 627810-06-4 |
| Synonyms | 3,6-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-9H-carbazole;diiodide |
| Molecular Formula | C28H25I2N3 |
| Purity | ≥95% |
| IUPAC Name | 3,6-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-9H-carbazole;diiodide |
| InChI | InChI=1S/C28H24N3.2HI/c1-30-15-11-21(12-16-30)3-5-23-7-9-27-25(19-23)26-20-24(8-10-28(26)29-27)6-4-22-13-17-31(2)18-14-22;;/h3-20H,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | FKOQWAUFKGFWLH-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=C(C=C1)C=CC2=CC3=C(C=C2)NC4=C3C=C(C=C4)C=CC5=CC=[N+](C=C5)C.[I-].[I-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
