For research use only. Not for therapeutic Use.
BMS493(CAT: I004576) is an inverse pan-retinoic acid receptor (RAR) agonist that enhances nuclear corepressor interaction with RARs and prevents retinoic acid–induced differentiation. Beyond its role as an RAR modulator, BMS493 functions as a click chemistry reagent, featuring an alkyne group capable of undergoing Cu(I)-catalyzed azide–alkyne cycloaddition (CuAAC). In umbilical cord blood–derived ALDH^hi cells, BMS493 (100 nM; 6 days) promotes a twofold expansion, increasing CD34^+ and CD133^+ populations while reducing CD38 expression. Despite enhancing hematopoietic stem/progenitor markers, expanded cells lose islet regenerative potential upon intrapancreatic transplantation in streptozotocin-induced diabetic mice.
| CAS Number | 215030-90-3 |
| Molecular Formula | C29H24O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[(E)-2-[5,5-dimethyl-8-(2-phenylethynyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid |
| InChI | InChI=1S/C29H24O2/c1-29(2)19-18-24(14-10-21-6-4-3-5-7-21)26-20-23(13-17-27(26)29)9-8-22-11-15-25(16-12-22)28(30)31/h3-9,11-13,15-18,20H,19H2,1-2H3,(H,30,31)/b9-8+ |
| InChIKey | YCADIXLLWMXYKW-CMDGGOBGSA-N |
| SMILES | CC1(CC=C(C2=C1C=CC(=C2)/C=C/C3=CC=C(C=C3)C(=O)O)C#CC4=CC=CC=C4)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
