For research use only. Not for therapeutic Use.
BMS-986121（Cat No.:I045273）is a potent, selective positive allosteric modulator (PAM) of the human adenosine A₂A receptor (A₂AR), a G protein–coupled receptor involved in immune regulation, vasodilation, and neurotransmission. By enhancing the receptor’s response to adenosine without directly activating it, BMS-986121 amplifies A₂AR signaling, offering therapeutic potential in conditions such as neurodegenerative diseases, cardiovascular disorders, and immune modulation. Its high potency, selectivity, and favorable pharmacokinetic properties make it a valuable research tool for studying adenosine-mediated signaling pathways and for exploring A₂AR-targeted therapies in inflammation, ischemia, and central nervous system disorders.
| CAS Number | 313671-26-0 |
| Synonyms | N-(2,6-dichlorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
| Molecular Formula | C15H9Cl2N3O2S |
| Purity | ≥95% |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
| InChI | InChI=1S/C15H9Cl2N3O2S/c16-11-2-1-3-12(17)14(11)19-15-18-13(8-23-15)9-4-6-10(7-5-9)20(21)22/h1-8H,(H,18,19) |
| InChIKey | AOCLKIVPDLQCOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NC2=NC(=CS2)C3=CC=C(C=C3)[N+](=O)[O-])Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
