For research use only. Not for therapeutic Use.
BMS-303141(CAT: I005616) is a potent and selective inhibitor of ATP-citrate lyase (ACL), exhibiting an IC₅₀ of 0.13 µM against human recombinant ACL. ACL is a key enzyme in lipid metabolism, catalyzing the conversion of citrate to acetyl-CoA, a precursor for fatty acid and cholesterol biosynthesis. By inhibiting ACL, BMS-303141 reduces lipid synthesis and modulates energy metabolism, making it a valuable compound in metabolic disease research, particularly for studying obesity, type 2 diabetes, and dyslipidemia. Additionally, its role in altering lipid metabolism positions it as a promising agent in oncology research for targeting tumor growth dependent on lipid biosynthesis.
| CAS Number | 943962-47-8 |
| Synonyms | BMS303141;BMS 303141 |
| Molecular Formula | C₁₉H₁₅Cl₂NO₄S |
| Purity | ≥95% |
| Target | ATP Citrate Lyase |
| Solubility | DMSO: ≥ 47 mg/mL |
| Storage | Store at -20C |
| IC50 | 0.13 uM |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-(2-methoxy-5-phenylphenyl)benzenesulfonamide |
| InChI | InChI=1S/C19H15Cl2NO4S/c1-26-17-8-7-13(12-5-3-2-4-6-12)9-16(17)22-27(24,25)18-11-14(20)10-15(21)19(18)23/h2-11,22-23H,1H3 |
| InChIKey | SIIPNDKXZOTLEA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)NS(=O)(=O)C3=CC(=CC(=C3O)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |