For research use only. Not for therapeutic Use.
BML-111（Cat No.:I004354）is a synthetic stable analog of lipoxin A4, an endogenous lipid mediator involved in the resolution phase of inflammation. Acting as an agonist of the ALX/FPR2 receptor, BML-111 promotes anti-inflammatory and pro-resolving signaling while inhibiting leukocyte recruitment and pro-inflammatory cytokine release. Researchers use BML-111 to study resolution biology, immune regulation, and chronic inflammatory disease mechanisms. Its ability to mimic lipoxin activity makes it a valuable tool in exploring therapeutic strategies for inflammatory disorders, ischemia-reperfusion injury, and immune-mediated pathologies where resolution pathways are impaired.
| CAS Number | 78606-80-1 |
| Synonyms | methyl (5S,6R)-5,6,7-trihydroxyheptanoate |
| Molecular Formula | C8H16O5 |
| Purity | ≥95% |
| IUPAC Name | methyl (5S,6R)-5,6,7-trihydroxyheptanoate |
| InChI | InChI=1S/C8H16O5/c1-13-8(12)4-2-3-6(10)7(11)5-9/h6-7,9-11H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | RNMFWAFZUNVQOR-NKWVEPMBSA-N |
| SMILES | COC(=O)CCC[C@@H]([C@@H](CO)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
