For research use only. Not for therapeutic Use.
Bis(phenylthio)methane(Cat No.:L007066), is an organic compound composed of a methane core (CH2) flanked by two phenylthio (-SPh) groups. It is utilized in organic synthesis as a sulfur-containing reagent, acting as a thioether source in various chemical reactions. Its unique structure allows it to participate in nucleophilic substitution and cross-coupling reactions, enabling the formation of complex organic molecules. Researchers employ bis(phenylthio)methane in the synthesis of pharmaceuticals, agrochemicals, and materials science applications, where the introduction of sulfur functionalities is crucial. Its significance lies in its role as a building block in the creation of diverse and structurally intricate compounds.
CAS Number | 3561-67-9 |
Molecular Formula | C13H12S2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | phenylsulfanylmethylsulfanylbenzene |
InChI | InChI=1S/C13H12S2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13/h1-10H,11H2 |
InChIKey | ZHUPZVIALZHGGP-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)SCSC2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |