Bisphenol A Diallyl Ether(Cat No.:M011062)is an organic compound derived from Bisphenol A, featuring diallyl ether groups. It is used primarily in the production of advanced polymers and resins, particularly for creating epoxy and phenolic resins with enhanced thermal stability and mechanical properties. These materials are vital in coatings, adhesives, and electronic components. However, like Bisphenol A, its safety is scrutinized due to potential endocrine-disrupting effects. Ongoing research aims to understand its environmental impact and health risks, balancing its industrial applications with safety considerations.
Catalog Number | M011062 |
CAS Number | 3739-67-1 |
Synonyms | 4,4/’-isopropylidenebis[(allyloxy)benzene];Bisphenol A diallyl ether;1,1/’-(1-Methylethylidene)bis[4-(2-propenyloxy)benzene];BBE;Bisphenol A bisallyl ether;PARA-DIALLYL ETHER BISPHENOL-A;DIALLYLETHER BISPHENOL A;3,3/’-[Dimethylmethylenebis(4,1-phenyl |
Molecular Formula | C21H24O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-prop-2-enoxy-4-[2-(4-prop-2-enoxyphenyl)propan-2-yl]benzene |
InChI | InChI=1S/C21H24O2/c1-5-15-22-19-11-7-17(8-12-19)21(3,4)18-9-13-20(14-10-18)23-16-6-2/h5-14H,1-2,15-16H2,3-4H3 |
InChIKey | SCZZNWQQCGSWSZ-UHFFFAOYSA-N |
SMILES | CC(C)(C1=CC=C(C=C1)OCC=C)C2=CC=C(C=C2)OCC=C |