Bisphenol A Bis(2,3-hydroxypropyl) Ether (Mixture of Diastereomers)(Cat No.:R058478), is a complex compound commonly used as a cross-linking agent and reactive diluent in the production of epoxy resins. It enhances the mechanical properties, stability, and adhesion of epoxy-based materials. This compound is particularly utilized in coatings, adhesives, and composites. Its unique structure, derived from bisphenol A and glycidol, contributes to its reactivity and ability to modify epoxy formulations.
Catalog Number | R058478 |
CAS Number | 5581-32-8 |
Synonyms | 3,3’-[(1-Methylethylidene)bis(4,1-phenyleneoxy)]bis-1,2-propanediol; 3,3’-[Isopropylidenebis(p-phenyleneoxy)]di-1,2-propanediol; 2,2-Bis[4-(2,3-dihydroxypropoxy)phenyl]propane; BADGE.2H2O; BADGETOL; |
Molecular Formula | C21H28O6 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 3-[4-[2-[4-(2,3-dihydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol |
InChI | InChI=1S/C21H28O6/c1-21(2,15-3-7-19(8-4-15)26-13-17(24)11-22)16-5-9-20(10-6-16)27-14-18(25)12-23/h3-10,17-18,22-25H,11-14H2,1-2H3 |
InChIKey | NISVZEWKUNUGQQ-UHFFFAOYSA-N |
SMILES | CC(C)(C1=CC=C(C=C1)OCC(CO)O)C2=CC=C(C=C2)OCC(CO)O |