For research use only. Not for therapeutic Use.
Bisdethiobis(methylthio)gliotoxin(Cat No.:R065832)is a derivative of gliotoxin, a potent mycotoxin known for its immunosuppressive properties. This compound features two methylthio groups attached to a central dihydroxyquinone structure, enhancing its chemical stability and modifying its biological activity. It has shown potential in inhibiting the growth of various fungi and exhibits anti-inflammatory effects, making it a valuable tool in pharmacological research. Due to its ability to disrupt cellular redox states and modulate immune responses, Bisdethiobis(methylthio)gliotoxin is explored for its therapeutic potential in autoimmune diseases and microbial infections.
| CAS Number | 74149-38-5 |
| Molecular Formula | C15H20N2O4S2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3R,5aS,6S,10aR)-6-hydroxy-3-(hydroxymethyl)-2-methyl-3,10a-bis(methylsulfanyl)-6,10-dihydro-5aH-pyrazino[1,2-a]indole-1,4-dione |
| InChI | InChI=1S/C15H20N2O4S2/c1-16-12(20)14(22-2)7-9-5-4-6-10(19)11(9)17(14)13(21)15(16,8-18)23-3/h4-6,10-11,18-19H,7-8H2,1-3H3/t10-,11-,14+,15+/m0/s1 |
| InChIKey | OVBAGMZLGLXSBN-UOVKNHIHSA-N |
| SMILES | CN1C(=O)[C@@]2(CC3=CC=C[C@@H]([C@H]3N2C(=O)[C@@]1(CO)SC)O)SC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |