For research use only. Not for therapeutic Use.
Bis(4-tert-butylphenyl)amine(CAT: L030693) is an aromatic secondary amine featuring two 4-tert-butylphenyl groups bonded to a central nitrogen atom. This compound is widely used in the development of organic electronic materials, particularly as a hole-transporting material (HTM) in OLEDs, perovskite solar cells, and other optoelectronic devices. The bulky tert-butyl groups enhance thermal stability, solubility, and resistance to oxidation, while the conjugated structure facilitates efficient charge mobility. It also serves as a precursor for synthesizing triarylamine derivatives and polymers. Due to its electron-donating character and robust molecular framework, bis(4-tert-butylphenyl)amine is a key component in advanced materials and molecular electronics research.
| CAS Number | 4627-22-9 |
| Molecular Formula | C20H27N |
| Purity | ≥95% |
| IUPAC Name | 4-tert-butyl-N-(4-tert-butylphenyl)aniline |
| InChI | InChI=1S/C20H27N/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6/h7-14,21H,1-6H3 |
| InChIKey | OPEKHRGERHDLRK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)NC2=CC=C(C=C2)C(C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |