For research use only. Not for therapeutic Use.
Bis(2-methoxyphenyl)phenylphosphine(Cat No.:L007070), is an organophosphorus compound widely used in coordination chemistry and organic synthesis. This compound features a phenylphosphine (-PPh₂) moiety attached to two 2-methoxyphenyl groups. It acts as a versatile ligand in transition metal catalysis, facilitating various chemical transformations including cross-coupling reactions and hydrogenation processes. Its ability to stabilize reactive metal complexes enhances catalytic efficiency. Researchers employ bis(2-methoxyphenyl)phenylphosphine in the development of new materials and pharmaceuticals. Its role as a ligand in organometallic chemistry significantly contributes to the creation of novel catalytic systems, enabling the synthesis of complex organic molecules for various scientific and industrial applications.
CAS Number | 36802-41-2 |
Molecular Formula | C20H19O2P |
Purity | ≥95% |
IUPAC Name | bis(2-methoxyphenyl)-phenylphosphane |
InChI | InChI=1S/C20H19O2P/c1-21-17-12-6-8-14-19(17)23(16-10-4-3-5-11-16)20-15-9-7-13-18(20)22-2/h3-15H,1-2H3 |
InChIKey | MVKZAEARORRRPG-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |