For research use only. Not for therapeutic Use.
Bis(triphenylphosphine)nickel(II) dichloride (Cat No.: R010904) is a coordination complex featuring a nickel(II) center bonded to two chloride ligands and two triphenylphosphine ligands. This bright red compound is widely used as a catalyst or catalyst precursor in organic synthesis, particularly in cross-coupling reactions such as Kumada and Negishi couplings. The triphenylphosphine ligands stabilize the nickel center and influence its reactivity and selectivity. Its well-defined structure and reactivity make it valuable in organometallic chemistry and the development of nickel-catalyzed synthetic methodologies.
| CAS Number | 14264-16-5 |
| Synonyms | Bis(triphenylphosphine)dichloronickel; Dichlorobis(triphenylphosphine)nickel; NSC 137147; |
| Molecular Formula | C₃₆H₃₀Cl₂NiP₂ |
| Purity | ≥95% |
| Storage | Store at 4°C |
| IUPAC Name | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Ni]Cl |
| InChI | InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2/p-2 |
| InChIKey | ZBRJXVVKPBZPAN-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Ni]Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
