For research use only. Not for therapeutic Use.
Bis(tri-tert-butylphosphine)palladium(0) (Cat No.: R021106)is a highly reactive palladium(0) complex widely used as a catalyst in cross-coupling reactions, such as Suzuki, Heck, and Stille reactions. It features a palladium center coordinated by two bulky tri-tert-butylphosphine ligands, which provide both steric hindrance and strong electron donation. This structure stabilizes the Pd(0) species and enhances its catalytic activity while suppressing decomposition. The compound is air-sensitive and typically handled under inert atmosphere. It is particularly effective in promoting couplings with hindered or deactivated aryl halides.
CAS Number | 53199-31-8 |
Synonyms | Bis[tris(1,1-dimethylethyl)phosphine]palladium; ?Bis(tri-tert-butylphosphine)palladium; Bis(tri-tert-butylphosphine)palladium(0); Bis(tri-tert-butylphosphino)palladium; Bis[tris(tert-butyl)phosphine]palladium; Palladium Bis(tri-tert-butylphosphine); |
Molecular Formula | C24H54P2Pd |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | palladium;tritert-butylphosphane |
InChI | InChI=1S/2C12H27P.Pd/c2*1-10(2,3)13(11(4,5)6)12(7,8)9;/h2*1-9H3; |
InChIKey | MXQOYLRVSVOCQT-UHFFFAOYSA-N |
SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C.[Pd] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |