For research use only. Not for therapeutic Use.
Bis-PEG4-PFP ester(CAT:I017116) is a homobifunctional PEGylated crosslinker containing two pentafluorophenyl (PFP) ester groups separated by a tetraethylene glycol (PEG4) spacer. The activated PFP esters react efficiently with primary amines to form stable amide bonds, enabling bioconjugation of proteins, peptides, and small molecules. Its hydrophilic PEG4 backbone enhances solubility, reduces steric hindrance, and improves linker flexibility, making it ideal for applications in drug delivery, antibody–drug conjugates (ADCs), and surface modification. Bis-PEG4-PFP ester is widely used in chemical biology and biomedical research where precise, amine-reactive crosslinking with controlled spacing and aqueous compatibility is required
| CAS Number | 1314378-12-5 |
| Synonyms | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]ethoxy]ethoxy]ethoxy]propanoate |
| Molecular Formula | C24H20F10O8 |
| Purity | ≥95% |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChI | InChI=1S/C24H20F10O8/c25-13-15(27)19(31)23(20(32)16(13)28)41-11(35)1-3-37-5-7-39-9-10-40-8-6-38-4-2-12(36)42-24-21(33)17(29)14(26)18(30)22(24)34/h1-10H2 |
| InChIKey | RCCGHSXHOCFIBV-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
