For research use only. Not for therapeutic Use.
[Bis(diphenylphosphino)ethane]dichloronickel(Cat No.:R025455), commonly abbreviated as NiCl₂(dppe), is a coordination complex featuring a nickel(II) center bonded to a bidentate bis(diphenylphosphino)ethane (dppe) ligand and two chloride ions. This square planar complex is widely used as a catalyst or catalyst precursor in organometallic and cross-coupling reactions, including carbon–carbon and carbon–heteroatom bond formations. The dppe ligand stabilizes the nickel center and tunes its electronic properties, making it valuable in homogeneous catalysis. Its well-defined structure and reactivity profile make it a versatile tool in synthetic and polymer chemistry applications.
CAS Number | 14647-23-5 |
Synonyms | (SP-4-2)-Dichloro[1,2-ethanediylbis[diphenylphosphine]-P,P’]nickel; cis-Dichloro[ethylenebis[diphenylphosphine]]nickel; 1,2-Ethanediylbis[diphenylphosphine Nickel Complex; 1,2-Bis(diphenylphosphino)ethanenickel Dichloride; 1,2-Ethylenebis(diphenylpho |
Molecular Formula | C₂₆H₂₄Cl₂NiP₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-diphenylphosphanylethyl(diphenyl)phosphane;nickel(2+);dichloride |
InChI | InChI=1S/C26H24P2.2ClH.Ni/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;;/h1-20H,21-22H2;2*1H;/q;;;+2/p-2 |
InChIKey | XXECWTBMGGXMKP-UHFFFAOYSA-L |
SMILES | C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.[Cl-].[Cl-].[Ni+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |