For research use only. Not for therapeutic Use.
Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)copper(II)(CAT: M057719) is a high-purity copper(II) coordination complex widely utilized in materials science, catalysis, and advanced research applications. Featuring two 2,2,6,6-tetramethyl-3,5-heptanedionate ligands, this compound exhibits excellent thermal stability and volatility, making it ideal for processes such as chemical vapor deposition (CVD) and atomic layer deposition (ALD) in thin-film and nanomaterial fabrication. Its well-defined structure and reactivity also make it valuable for catalytic applications in organic and inorganic synthesis. Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)copper(II) is a dependable choice for researchers seeking precise and reliable materials for cutting-edge technological and scientific advancements.
| CAS Number | 14040-05-2 |
| Molecular Formula | C22H38CuO4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | copper;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one |
| InChI | InChI=1S/2C11H20O2.Cu/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*7,12H,1-6H3;/b2*8-7-; |
| InChIKey | PEMCLTTUCGSLGJ-ATMONBRVSA-N |
| SMILES | CC(/C(=C/C(=O)C(C)(C)C)/O)(C)C.CC(/C(=C/C(=O)C(C)(C)C)/O)(C)C.[Cu] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |