For research use only. Not for therapeutic Use.
Biricodar (Cat No.:M046023) is a potent modulator of multidrug resistance (MDR) in cancer therapy. It targets P-glycoprotein (P-gp) and multidrug resistance-associated protein (MRP), which are often overexpressed in resistant cancer cells, leading to improved efficacy of chemotherapeutic agents. By inhibiting these efflux pumps, Biricodar enhances drug accumulation within cancer cells, thereby overcoming resistance and promoting cell death. It is used in research and clinical trials to enhance the effectiveness of standard cancer treatments, making it a promising adjunct in the fight against multidrug-resistant cancers.
| CAS Number | 159997-94-1 |
| Synonyms | 1,7-dipyridin-3-ylheptan-4-yl (2S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
| Molecular Formula | C34H41N3O7 |
| Purity | ≥95% |
| IUPAC Name | 1,7-dipyridin-3-ylheptan-4-yl (2S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
| InChI | InChI=1S/C34H41N3O7/c1-41-29-20-26(21-30(42-2)32(29)43-3)31(38)33(39)37-19-5-4-16-28(37)34(40)44-27(14-6-10-24-12-8-17-35-22-24)15-7-11-25-13-9-18-36-23-25/h8-9,12-13,17-18,20-23,27-28H,4-7,10-11,14-16,19H2,1-3H3/t28-/m0/s1 |
| InChIKey | CGVWPQOFHSAKRR-NDEPHWFRSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)C(=O)N2CCCCC2C(=O)OC(CCCC3=CN=CC=C3)CCCC4=CN=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |