For research use only. Not for therapeutic Use.
Biotin-PEG5-amine(CAT: I014213) is a biotinylated linker containing a primary amine group and a PEG5 spacer. The terminal amine enables versatile conjugation through amide bond formation with activated esters such as NHS esters or carboxylic acids, allowing efficient labeling of biomolecules, peptides, and polymers. The PEG5 chain enhances solubility, flexibility, and reduces steric hindrance, improving reaction efficiency in bioconjugation applications. The biotin moiety ensures strong, specific binding to streptavidin or avidin, making it highly useful for detection, immobilization, and affinity-based assays. Biotin-PEG5-amine is widely applied in chemical biology, diagnostics, and drug discovery for biotinylation and molecular tracking studies.
| CAS Number | 113072-75-6 |
| Synonyms | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| Molecular Formula | C22H42N4O7S |
| Purity | ≥95% |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| InChI | InChI=1S/C22H42N4O7S/c23-5-7-29-9-11-31-13-15-33-16-14-32-12-10-30-8-6-24-20(27)4-2-1-3-19-21-18(17-34-19)25-22(28)26-21/h18-19,21H,1-17,23H2,(H,24,27)(H2,25,26,28)/t18-,19-,21-/m0/s1 |
| InChIKey | BYKYZTMBWRTPIJ-ZJOUEHCJSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCOCCOCCOCCN)NC(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
