For research use only. Not for therapeutic Use.
Biotin-PEG4-alkyne(CAT: I014206) is a biotinylated probe featuring a terminal alkyne group and a flexible polyethylene glycol (PEG4) spacer. The alkyne group enables efficient copper-catalyzed azide–alkyne cycloaddition (CuAAC, “click chemistry”) with azide-functionalized biomolecules, allowing precise and stable conjugation. The PEG4 linker enhances solubility and reduces steric hindrance, improving bioconjugation efficiency. The biotin moiety provides strong affinity for streptavidin and avidin systems, facilitating detection, enrichment, and immobilization of labeled molecules. Biotin-PEG4-alkyne is widely applied in chemical biology, proteomics, and drug discovery research for studying protein interactions, biomolecular tracking, and high-sensitivity assay development.
| CAS Number | 1458576-00-5 |
| Synonyms | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| Molecular Formula | C21H35N3O6S |
| Purity | ≥95% |
| IUPAC Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| InChI | InChI=1S/C21H35N3O6S/c1-2-8-27-10-12-29-14-15-30-13-11-28-9-7-22-19(25)6-4-3-5-18-20-17(16-31-18)23-21(26)24-20/h1,17-18,20H,3-16H2,(H,22,25)(H2,23,24,26)/t17-,18-,20-/m1/s1 |
| InChIKey | SKMJWNZZFUDLKQ-QWFCFKBJSA-N |
| SMILES | C#CCOCCOCCOCCOCCNC(=O)CCCCC1C2C(CS1)NC(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
