For research use only. Not for therapeutic Use.
Biotin-PEG3-OH（Cat No.:I016185）is a hydrophilic biotinylated linker commonly used in bioconjugation, labeling, and assay development. The biotin group provides strong, specific binding to avidin or streptavidin, enabling detection, enrichment, and immobilization of biomolecules. The PEG3 spacer improves aqueous solubility, enhances flexibility, and reduces steric hindrance, ensuring efficient biotin–protein interactions in complex systems. The terminal hydroxyl group serves as a versatile handle for further chemical modification or functionalization. This reagent is widely applied in proteomics, diagnostics, imaging, and drug delivery research where reliable biotinylation with minimal interference is required.
| CAS Number | 1263044-40-1 |
| Synonyms | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| Molecular Formula | C16H29N3O5S |
| Purity | ≥95% |
| IUPAC Name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChI | InChI=1S/C16H29N3O5S/c20-6-8-24-10-9-23-7-5-17-14(21)4-2-1-3-13-15-12(11-25-13)18-16(22)19-15/h12-13,15,20H,1-11H2,(H,17,21)(H2,18,19,22) |
| InChIKey | JMPJDHGWKSPEEE-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCO)NC(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
